CAS 2223009-19-4 is the registry number for 5–(tetrahydrofuran–2–yl)–2–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
5-(oxolan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223009-19-4) is a chemical compound with the molecular formula C15H22BNO3 and a molecular weight of 275.15 g/mol. IUPAC name: 5-(oxolan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: INPYLTWFRRRFGH-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO3 |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | 5-(oxolan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | INPYLTWFRRRFGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=C(C=C2)C3CCCO3 |
Computed by PubChem (NCBI)