CAS 2223009-30-9 is the registry number for 2-(2-Fluoro-4-(tetrahydrofuran-3-yl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2-[2-fluoro-4-(oxolan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223009-30-9) is a chemical compound with the molecular formula C16H22BFO3 and a molecular weight of 292.2 g/mol. IUPAC name: 2-[2-fluoro-4-(oxolan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FYWLOPNBNAYDCF-UHFFFAOYSA-N.
| Molecular formula | C16H22BFO3 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-[2-fluoro-4-(oxolan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FYWLOPNBNAYDCF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3CCOC3)F |
Computed by PubChem (NCBI)