Products 2223029-70-5
CAS 2223029-70-5 is the registry number for 2-(2-Cyclopropyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
2-(2-cyclopropyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223029-70-5) is a chemical compound with the molecular formula C15H20BFO2 and a molecular weight of 262.13 g/mol. IUPAC name: 2-(2-cyclopropyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CTOWMHPHENZDLU-UHFFFAOYSA-N.
| Molecular formula | C15H20BFO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 2-(2-cyclopropyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CTOWMHPHENZDLU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)C3CC3 |
Computed by PubChem (NCBI)