CAS 2223030-53-1 is the registry number for 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidine-2,4-dione (CAS 2223030-53-1) is a chemical compound with the molecular formula C10H15BN2O4 and a molecular weight of 238.05 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidine-2,4-dione. InChIKey: NRQYCMMAJTYSGE-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O4 |
|---|---|
| Molecular weight | 238.05 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidine-2,4-dione |
| InChIKey | NRQYCMMAJTYSGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC(=O)NC2=O |
Computed by PubChem (NCBI)