CAS 2223031-70-5 appears in our catalog under these names: 4–(1–Hydroxy–1–methylethyl)thiophene–3–boronic acid pinacol ester, 2-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl)propan-2-ol, 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 25mg, 250mg, 1g.
2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl]propan-2-ol (CAS 2223031-70-5) is a chemical compound with the molecular formula C13H21BO3S and a molecular weight of 268.2 g/mol. IUPAC name: 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl]propan-2-ol. InChIKey: PCNBPZSHWMEWFO-UHFFFAOYSA-N.
| Molecular formula | C13H21BO3S |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl]propan-2-ol |
| InChIKey | PCNBPZSHWMEWFO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C(C)(C)O |
Computed by PubChem (NCBI)