CAS 2223033-77-8 is the registry number for 3–(Acetyl)thiophene–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(3-acetylthiophen-2-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (CAS 2223033-77-8) is a chemical compound with the molecular formula C12H19BO4S and a molecular weight of 270.16 g/mol. IUPAC name: (3-acetylthiophen-2-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid. InChIKey: LFAWISWHDDMTRZ-UHFFFAOYSA-N.
| Molecular formula | C12H19BO4S |
|---|---|
| Molecular weight | 270.16 g/mol |
| IUPAC name | (3-acetylthiophen-2-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| InChIKey | LFAWISWHDDMTRZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CS1)C(=O)C)(O)OC(C)(C)C(C)(C)O |
Computed by PubChem (NCBI)