CAS 2223054-10-0 is the registry number for 1-[3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrrole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole (CAS 2223054-10-0) is a chemical compound with the molecular formula C16H19BFNO2 and a molecular weight of 287.1 g/mol. IUPAC name: 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole. InChIKey: UDUYTZMMSYANIB-UHFFFAOYSA-N.
| Molecular formula | C16H19BFNO2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole |
| InChIKey | UDUYTZMMSYANIB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)N3C=CC=C3)F |
Computed by PubChem (NCBI)