CAS 22247-87-6 is the registry number for 7-(2-Chloroethyl)guanine. Offered by: TRC. Available pack sizes: 1g.
2-amino-7-(2-chloroethyl)-1H-purin-6-one (CAS 22247-87-6) is a chemical compound with the molecular formula C7H8ClN5O and a molecular weight of 213.62 g/mol. IUPAC name: 2-amino-7-(2-chloroethyl)-1H-purin-6-one. InChIKey: SULBUWBTSDCEDY-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN5O |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 2-amino-7-(2-chloroethyl)-1H-purin-6-one |
| InChIKey | SULBUWBTSDCEDY-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1CCCl)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)