CAS 2225136-71-8 is the registry number for 2-bromo-6-chloroaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-bromo-6-chloroaniline;hydrochloride (CAS 2225136-71-8) is a chemical compound with the molecular formula C6H6BrCl2N and a molecular weight of 242.93 g/mol. IUPAC name: 2-bromo-6-chloroaniline;hydrochloride. InChIKey: MQKSJIRHOOGZEW-UHFFFAOYSA-N.
| Molecular formula | C6H6BrCl2N |
|---|---|
| Molecular weight | 242.93 g/mol |
| IUPAC name | 2-bromo-6-chloroaniline;hydrochloride |
| InChIKey | MQKSJIRHOOGZEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)N)Cl.Cl |
Computed by PubChem (NCBI)