CAS 2225142-27-6 is the registry number for 2H,4H,5H,6H-Pyrrolo(3,4-c)pyrazole-4-carboxamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide;dihydrochloride (CAS 2225142-27-6) is a chemical compound with the molecular formula C6H10Cl2N4O and a molecular weight of 225.07 g/mol. IUPAC name: 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide;dihydrochloride. InChIKey: XEOQELKMANOTOQ-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl2N4O |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide;dihydrochloride |
| InChIKey | XEOQELKMANOTOQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=NN2)C(N1)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)