CAS 2225143-96-2 is the registry number for 3-Fluoro-4-methoxypyridine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-fluoro-4-methoxypyridine-2-carboxylic acid;hydrochloride (CAS 2225143-96-2) is a chemical compound with the molecular formula C7H7ClFNO3 and a molecular weight of 207.58 g/mol. IUPAC name: 3-fluoro-4-methoxypyridine-2-carboxylic acid;hydrochloride. InChIKey: LTDYGADGKGPOME-UHFFFAOYSA-N.
| Molecular formula | C7H7ClFNO3 |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | 3-fluoro-4-methoxypyridine-2-carboxylic acid;hydrochloride |
| InChIKey | LTDYGADGKGPOME-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)C(=O)O)F.Cl |
Computed by PubChem (NCBI)