Products 2225146-51-8
CAS 2225146-51-8 is the registry number for 1H-Pyrrolo(3,2-b)pyridin-3-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1H-pyrrolo[3,2-b]pyridin-3-ol;hydrochloride (CAS 2225146-51-8) is a chemical compound with the molecular formula C7H7ClN2O and a molecular weight of 170.59 g/mol. IUPAC name: 1H-pyrrolo[3,2-b]pyridin-3-ol;hydrochloride. InChIKey: VPPFUIVRTDQZAC-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O |
|---|---|
| Molecular weight | 170.59 g/mol |
| IUPAC name | 1H-pyrrolo[3,2-b]pyridin-3-ol;hydrochloride |
| InChIKey | VPPFUIVRTDQZAC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)O)N=C1.Cl |
Computed by PubChem (NCBI)