CAS 2225155-55-3 is the registry number for 3–Fluoro–5–(4–methylimidazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[3-fluoro-5-(4-methylimidazol-1-yl)phenyl]boronic acid (CAS 2225155-55-3) is a chemical compound with the molecular formula C10H10BFN2O2 and a molecular weight of 220.01 g/mol. IUPAC name: [3-fluoro-5-(4-methylimidazol-1-yl)phenyl]boronic acid. InChIKey: BBKVJHCFMMOHFN-UHFFFAOYSA-N.
| Molecular formula | C10H10BFN2O2 |
|---|---|
| Molecular weight | 220.01 g/mol |
| IUPAC name | [3-fluoro-5-(4-methylimidazol-1-yl)phenyl]boronic acid |
| InChIKey | BBKVJHCFMMOHFN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)N2C=C(N=C2)C)(O)O |
Computed by PubChem (NCBI)