CAS 2225155-60-0 is the registry number for 4–Chloro–2–(2–furyl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-chloro-2-(furan-2-yl)pyrimidin-5-yl]boronic acid (CAS 2225155-60-0) is a chemical compound with the molecular formula C8H6BClN2O3 and a molecular weight of 224.41 g/mol. IUPAC name: [4-chloro-2-(furan-2-yl)pyrimidin-5-yl]boronic acid. InChIKey: HMQYYUWXBIXZAX-UHFFFAOYSA-N.
| Molecular formula | C8H6BClN2O3 |
|---|---|
| Molecular weight | 224.41 g/mol |
| IUPAC name | [4-chloro-2-(furan-2-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | HMQYYUWXBIXZAX-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1Cl)C2=CC=CO2)(O)O |
Computed by PubChem (NCBI)