CAS 2225155-77-9 is the registry number for 4–(1H–Pyrazol–1–yl)thiophene–2–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(4-pyrazol-1-ylthiophen-2-yl)boronic acid (CAS 2225155-77-9) is a chemical compound with the molecular formula C7H7BN2O2S and a molecular weight of 194.02 g/mol. IUPAC name: (4-pyrazol-1-ylthiophen-2-yl)boronic acid. InChIKey: LDBGYWRPOLUCQK-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2S |
|---|---|
| Molecular weight | 194.02 g/mol |
| IUPAC name | (4-pyrazol-1-ylthiophen-2-yl)boronic acid |
| InChIKey | LDBGYWRPOLUCQK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CS1)N2C=CC=N2)(O)O |
Computed by PubChem (NCBI)