CAS 2225169-01-5 is the registry number for 2–Bromo–4–(1H–pyrrol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-bromo-4-pyrrol-1-ylphenyl)boronic acid (CAS 2225169-01-5) is a chemical compound with the molecular formula C10H9BBrNO2 and a molecular weight of 265.90 g/mol. IUPAC name: (2-bromo-4-pyrrol-1-ylphenyl)boronic acid. InChIKey: XYESQELEKJPQHI-UHFFFAOYSA-N.
| Molecular formula | C10H9BBrNO2 |
|---|---|
| Molecular weight | 265.90 g/mol |
| IUPAC name | (2-bromo-4-pyrrol-1-ylphenyl)boronic acid |
| InChIKey | XYESQELEKJPQHI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)