CAS 2225169-43-5 is the registry number for 4–Fluoro–2–(pyrazin–2–yl)pyridine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(4-fluoro-6-pyrazin-2-yl-3-pyridinyl)boronic acid (CAS 2225169-43-5) is a chemical compound with the molecular formula C9H7BFN3O2 and a molecular weight of 218.98 g/mol. IUPAC name: (4-fluoro-6-pyrazin-2-yl-3-pyridinyl)boronic acid. InChIKey: YLPGVCFREQYFBJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BFN3O2 |
|---|---|
| Molecular weight | 218.98 g/mol |
| IUPAC name | (4-fluoro-6-pyrazin-2-yl-3-pyridinyl)boronic acid |
| InChIKey | YLPGVCFREQYFBJ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1F)C2=NC=CN=C2)(O)O |
Computed by PubChem (NCBI)