CAS 2225169-93-5 is the registry number for 2–Bromo–4–(3–methyl–1H–pyrazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[2-bromo-4-(3-methylpyrazol-1-yl)phenyl]boronic acid (CAS 2225169-93-5) is a chemical compound with the molecular formula C10H10BBrN2O2 and a molecular weight of 280.92 g/mol. IUPAC name: [2-bromo-4-(3-methylpyrazol-1-yl)phenyl]boronic acid. InChIKey: JACMWJZQDAUPOB-UHFFFAOYSA-N.
| Molecular formula | C10H10BBrN2O2 |
|---|---|
| Molecular weight | 280.92 g/mol |
| IUPAC name | [2-bromo-4-(3-methylpyrazol-1-yl)phenyl]boronic acid |
| InChIKey | JACMWJZQDAUPOB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CC(=N2)C)Br)(O)O |
Computed by PubChem (NCBI)