CAS 2225170-85-2 is the registry number for 3–Methyl–1–(2–chlorophenyl)pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
[1-(2-chlorophenyl)-3-methylpyrazol-4-yl]boronic acid (CAS 2225170-85-2) is a chemical compound with the molecular formula C10H10BClN2O2 and a molecular weight of 236.46 g/mol. IUPAC name: [1-(2-chlorophenyl)-3-methylpyrazol-4-yl]boronic acid. InChIKey: DLZFQXCGKBTVIF-UHFFFAOYSA-N.
| Molecular formula | C10H10BClN2O2 |
|---|---|
| Molecular weight | 236.46 g/mol |
| IUPAC name | [1-(2-chlorophenyl)-3-methylpyrazol-4-yl]boronic acid |
| InChIKey | DLZFQXCGKBTVIF-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C)C2=CC=CC=C2Cl)(O)O |
Computed by PubChem (NCBI)