CAS 2225170-96-5 is the registry number for 5–(TERT–BUTYL)–2–TRIFLUOROMETHYLPYRIDINE–4–BORONIC ACID. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[5-tert-butyl-2-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2225170-96-5) is a chemical compound with the molecular formula C10H13BF3NO2 and a molecular weight of 247.02 g/mol. IUPAC name: [5-tert-butyl-2-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: FNYJBSSDDQVRQV-UHFFFAOYSA-N.
| Molecular formula | C10H13BF3NO2 |
|---|---|
| Molecular weight | 247.02 g/mol |
| IUPAC name | [5-tert-butyl-2-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | FNYJBSSDDQVRQV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1C(C)(C)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)