CAS 2225172-00-7 is the registry number for 3–Methyl–1–(thiazol–2–yl)pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]boronic acid (CAS 2225172-00-7) is a chemical compound with the molecular formula C7H8BN3O2S and a molecular weight of 209.04 g/mol. IUPAC name: [3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]boronic acid. InChIKey: PZSIQSZVFJUVNV-UHFFFAOYSA-N.
| Molecular formula | C7H8BN3O2S |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | [3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]boronic acid |
| InChIKey | PZSIQSZVFJUVNV-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C)C2=NC=CS2)(O)O |
Computed by PubChem (NCBI)