CAS 2225172-02-9 is the registry number for 3–Cyclopropyl–5–(thiazol–2–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-cyclopropyl-5-(1,3-thiazol-2-yl)phenyl]boronic acid (CAS 2225172-02-9) is a chemical compound with the molecular formula C12H12BNO2S and a molecular weight of 245.11 g/mol. IUPAC name: [3-cyclopropyl-5-(1,3-thiazol-2-yl)phenyl]boronic acid. InChIKey: TVSVZCPRNQAARD-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO2S |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | [3-cyclopropyl-5-(1,3-thiazol-2-yl)phenyl]boronic acid |
| InChIKey | TVSVZCPRNQAARD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C2CC2)C3=NC=CS3)(O)O |
Computed by PubChem (NCBI)