CAS 2225172-27-8 is the registry number for 3–(6–Bromopyridin–2–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[3-(6-bromo-2-pyridinyl)phenyl]boronic acid (CAS 2225172-27-8) is a chemical compound with the molecular formula C11H9BBrNO2 and a molecular weight of 277.91 g/mol. IUPAC name: [3-(6-bromo-2-pyridinyl)phenyl]boronic acid. InChIKey: FHCKNJFJOOORKU-UHFFFAOYSA-N.
| Molecular formula | C11H9BBrNO2 |
|---|---|
| Molecular weight | 277.91 g/mol |
| IUPAC name | [3-(6-bromo-2-pyridinyl)phenyl]boronic acid |
| InChIKey | FHCKNJFJOOORKU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NC(=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)