CAS 2225172-52-9 is the registry number for 2–Fluoro–6–(3–tolyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-fluoro-6-(3-methylphenyl)-3-pyridinyl]boronic acid (CAS 2225172-52-9) is a chemical compound with the molecular formula C12H11BFNO2 and a molecular weight of 231.03 g/mol. IUPAC name: [2-fluoro-6-(3-methylphenyl)-3-pyridinyl]boronic acid. InChIKey: TUAOMZUFLDFVEE-UHFFFAOYSA-N.
| Molecular formula | C12H11BFNO2 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | [2-fluoro-6-(3-methylphenyl)-3-pyridinyl]boronic acid |
| InChIKey | TUAOMZUFLDFVEE-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C2=CC=CC(=C2)C)F)(O)O |
Computed by PubChem (NCBI)