CAS 2225173-89-5 is the registry number for 1–(3,5–Difluorophenyl)–1H–pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[1-(3,5-difluorophenyl)pyrazol-4-yl]boronic acid (CAS 2225173-89-5) is a chemical compound with the molecular formula C9H7BF2N2O2 and a molecular weight of 223.97 g/mol. IUPAC name: [1-(3,5-difluorophenyl)pyrazol-4-yl]boronic acid. InChIKey: TWTRIEVZIIBSCJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BF2N2O2 |
|---|---|
| Molecular weight | 223.97 g/mol |
| IUPAC name | [1-(3,5-difluorophenyl)pyrazol-4-yl]boronic acid |
| InChIKey | TWTRIEVZIIBSCJ-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC(=CC(=C2)F)F)(O)O |
Computed by PubChem (NCBI)