CAS 2225174-42-3 is the registry number for 2–Bromo–3–cyclopropyl–5–trifluoromethylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[2-bromo-3-cyclopropyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 2225174-42-3) is a chemical compound with the molecular formula C10H9BBrF3O2 and a molecular weight of 308.89 g/mol. IUPAC name: [2-bromo-3-cyclopropyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: RJWUBEKAVPQDEW-UHFFFAOYSA-N.
| Molecular formula | C10H9BBrF3O2 |
|---|---|
| Molecular weight | 308.89 g/mol |
| IUPAC name | [2-bromo-3-cyclopropyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | RJWUBEKAVPQDEW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Br)C2CC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)