CAS 2225174-49-0 is the registry number for 5–Chloro–6–(4–trifluoromethylphenyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[5-chloro-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]boronic acid (CAS 2225174-49-0) is a chemical compound with the molecular formula C12H8BClF3NO2 and a molecular weight of 301.46 g/mol. IUPAC name: [5-chloro-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]boronic acid. InChIKey: GPINVJXSBCDEJN-UHFFFAOYSA-N.
| Molecular formula | C12H8BClF3NO2 |
|---|---|
| Molecular weight | 301.46 g/mol |
| IUPAC name | [5-chloro-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]boronic acid |
| InChIKey | GPINVJXSBCDEJN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C2=CC=C(C=C2)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)