CAS 2225174-55-8 is the registry number for 4–Chloro–2–(2–fluorophenyl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-chloro-2-(2-fluorophenyl)pyrimidin-5-yl]boronic acid (CAS 2225174-55-8) is a chemical compound with the molecular formula C10H7BClFN2O2 and a molecular weight of 252.44 g/mol. IUPAC name: [4-chloro-2-(2-fluorophenyl)pyrimidin-5-yl]boronic acid. InChIKey: UANVMEVCVXSXMB-UHFFFAOYSA-N.
| Molecular formula | C10H7BClFN2O2 |
|---|---|
| Molecular weight | 252.44 g/mol |
| IUPAC name | [4-chloro-2-(2-fluorophenyl)pyrimidin-5-yl]boronic acid |
| InChIKey | UANVMEVCVXSXMB-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1Cl)C2=CC=CC=C2F)(O)O |
Computed by PubChem (NCBI)