CAS 2225175-87-9 is the registry number for 2–Iodo–6–(piperidin–4–yl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(2-iodo-6-piperidin-4-yl-4-pyridinyl)boronic acid (CAS 2225175-87-9) is a chemical compound with the molecular formula C10H14BIN2O2 and a molecular weight of 331.95 g/mol. IUPAC name: (2-iodo-6-piperidin-4-yl-4-pyridinyl)boronic acid. InChIKey: PHANELBVQPTOIC-UHFFFAOYSA-N.
| Molecular formula | C10H14BIN2O2 |
|---|---|
| Molecular weight | 331.95 g/mol |
| IUPAC name | (2-iodo-6-piperidin-4-yl-4-pyridinyl)boronic acid |
| InChIKey | PHANELBVQPTOIC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)I)C2CCNCC2)(O)O |
Computed by PubChem (NCBI)