CAS 2225176-08-7 is the registry number for 2–Cyano–4–(1H–pyrrol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-cyano-4-pyrrol-1-ylphenyl)boronic acid (CAS 2225176-08-7) is a chemical compound with the molecular formula C11H9BN2O2 and a molecular weight of 212.01 g/mol. IUPAC name: (2-cyano-4-pyrrol-1-ylphenyl)boronic acid. InChIKey: BNVZGWOQOUKEAX-UHFFFAOYSA-N.
| Molecular formula | C11H9BN2O2 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | (2-cyano-4-pyrrol-1-ylphenyl)boronic acid |
| InChIKey | BNVZGWOQOUKEAX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CC=C2)C#N)(O)O |
Computed by PubChem (NCBI)