CAS 2225176-31-6 is the registry number for 4–Fluoro–2–methyl–5–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(5-cyclopropyl-4-fluoro-2-methylphenyl)boronic acid (CAS 2225176-31-6) is a chemical compound with the molecular formula C10H12BFO2 and a molecular weight of 194.01 g/mol. IUPAC name: (5-cyclopropyl-4-fluoro-2-methylphenyl)boronic acid. InChIKey: WXHNAQACOJMHAJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BFO2 |
|---|---|
| Molecular weight | 194.01 g/mol |
| IUPAC name | (5-cyclopropyl-4-fluoro-2-methylphenyl)boronic acid |
| InChIKey | WXHNAQACOJMHAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)C2CC2)(O)O |
Computed by PubChem (NCBI)