CAS 2225176-70-3 is the registry number for 4–Methyl–2–(4–methyl–1H–pyrazol–1–yl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[4-methyl-2-(4-methylpyrazol-1-yl)pyrimidin-5-yl]boronic acid (CAS 2225176-70-3) is a chemical compound with the molecular formula C9H11BN4O2 and a molecular weight of 218.02 g/mol. IUPAC name: [4-methyl-2-(4-methylpyrazol-1-yl)pyrimidin-5-yl]boronic acid. InChIKey: WBEDBFBVIYSZER-UHFFFAOYSA-N.
| Molecular formula | C9H11BN4O2 |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | [4-methyl-2-(4-methylpyrazol-1-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | WBEDBFBVIYSZER-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1C)N2C=C(C=N2)C)(O)O |
Computed by PubChem (NCBI)