CAS 2225176-99-6 is the registry number for 3–(4–Trifluoromethylpyridin–2–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[3-[4-(trifluoromethyl)-2-pyridinyl]phenyl]boronic acid (CAS 2225176-99-6) is a chemical compound with the molecular formula C12H9BF3NO2 and a molecular weight of 267.01 g/mol. IUPAC name: [3-[4-(trifluoromethyl)-2-pyridinyl]phenyl]boronic acid. InChIKey: OZLWBNCWIZSWGT-UHFFFAOYSA-N.
| Molecular formula | C12H9BF3NO2 |
|---|---|
| Molecular weight | 267.01 g/mol |
| IUPAC name | [3-[4-(trifluoromethyl)-2-pyridinyl]phenyl]boronic acid |
| InChIKey | OZLWBNCWIZSWGT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)