CAS 2225177-27-3 is the registry number for (2–(thiazol–4–yl)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(1,3-thiazol-4-yl)pyrimidin-5-yl]boronic acid (CAS 2225177-27-3) is a chemical compound with the molecular formula C7H6BN3O2S and a molecular weight of 207.02 g/mol. IUPAC name: [2-(1,3-thiazol-4-yl)pyrimidin-5-yl]boronic acid. InChIKey: KZNXQKFMJIOTCJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BN3O2S |
|---|---|
| Molecular weight | 207.02 g/mol |
| IUPAC name | [2-(1,3-thiazol-4-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | KZNXQKFMJIOTCJ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C2=CSC=N2)(O)O |
Computed by PubChem (NCBI)