CAS 2225177-42-2 appears in our catalog under these names: 2–Fluoro–6–(methoxycarbonyl)pyridine–3–boronic acid, [2-fluoro-6-(methoxycarbonyl)pyridin-3-yl]boronic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 25mg, 5mg, 1g.
(2-fluoro-6-methoxycarbonyl-3-pyridinyl)boronic acid (CAS 2225177-42-2) is a chemical compound with the molecular formula C7H7BFNO4 and a molecular weight of 198.95 g/mol. IUPAC name: (2-fluoro-6-methoxycarbonyl-3-pyridinyl)boronic acid. InChIKey: BRPQOOIZEOTBDB-UHFFFAOYSA-N.
| Molecular formula | C7H7BFNO4 |
|---|---|
| Molecular weight | 198.95 g/mol |
| IUPAC name | (2-fluoro-6-methoxycarbonyl-3-pyridinyl)boronic acid |
| InChIKey | BRPQOOIZEOTBDB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)