CAS 2225177-75-1 is the registry number for 4–Chloro–2–(2–thienyl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(4-chloro-2-thiophen-2-ylpyrimidin-5-yl)boronic acid (CAS 2225177-75-1) is a chemical compound with the molecular formula C8H6BClN2O2S and a molecular weight of 240.48 g/mol. IUPAC name: (4-chloro-2-thiophen-2-ylpyrimidin-5-yl)boronic acid. InChIKey: WGZOQEJDMAEEPZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BClN2O2S |
|---|---|
| Molecular weight | 240.48 g/mol |
| IUPAC name | (4-chloro-2-thiophen-2-ylpyrimidin-5-yl)boronic acid |
| InChIKey | WGZOQEJDMAEEPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1Cl)C2=CC=CS2)(O)O |
Computed by PubChem (NCBI)