CAS 2225177-87-5 is the registry number for 5–Chloro–6–(1H–pyrrol–1–yl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(5-chloro-6-pyrrol-1-yl-3-pyridinyl)boronic acid (CAS 2225177-87-5) is a chemical compound with the molecular formula C9H8BClN2O2 and a molecular weight of 222.44 g/mol. IUPAC name: (5-chloro-6-pyrrol-1-yl-3-pyridinyl)boronic acid. InChIKey: JQOOTOMOKHSYEQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BClN2O2 |
|---|---|
| Molecular weight | 222.44 g/mol |
| IUPAC name | (5-chloro-6-pyrrol-1-yl-3-pyridinyl)boronic acid |
| InChIKey | JQOOTOMOKHSYEQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)N2C=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)