CAS 2225178-85-6 is the registry number for 2–Cyclopropyl–4–(1H–pyrazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(2-cyclopropyl-4-pyrazol-1-ylphenyl)boronic acid (CAS 2225178-85-6) is a chemical compound with the molecular formula C12H13BN2O2 and a molecular weight of 228.06 g/mol. IUPAC name: (2-cyclopropyl-4-pyrazol-1-ylphenyl)boronic acid. InChIKey: UTKWFGDLZURFSF-UHFFFAOYSA-N.
| Molecular formula | C12H13BN2O2 |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | (2-cyclopropyl-4-pyrazol-1-ylphenyl)boronic acid |
| InChIKey | UTKWFGDLZURFSF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CC=N2)C3CC3)(O)O |
Computed by PubChem (NCBI)