CAS 2225179-41-7 is the registry number for 4–Methyl–3–trifluoromethyl–6–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[2-cyclopropyl-4-methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 2225179-41-7) is a chemical compound with the molecular formula C11H12BF3O2 and a molecular weight of 244.02 g/mol. IUPAC name: [2-cyclopropyl-4-methyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: XKSKZOGHVMIITP-UHFFFAOYSA-N.
| Molecular formula | C11H12BF3O2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | [2-cyclopropyl-4-methyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | XKSKZOGHVMIITP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C2CC2)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)