CAS 2225179-43-9 is the registry number for 5–Chloro–2–(cyclopropyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(5-chloro-2-cyclopropyl-3-pyridinyl)boronic acid (CAS 2225179-43-9) is a chemical compound with the molecular formula C8H9BClNO2 and a molecular weight of 197.43 g/mol. IUPAC name: (5-chloro-2-cyclopropyl-3-pyridinyl)boronic acid. InChIKey: VYTWGQPHCYCOSZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BClNO2 |
|---|---|
| Molecular weight | 197.43 g/mol |
| IUPAC name | (5-chloro-2-cyclopropyl-3-pyridinyl)boronic acid |
| InChIKey | VYTWGQPHCYCOSZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1C2CC2)Cl)(O)O |
Computed by PubChem (NCBI)