CAS 2225179-49-5 is the registry number for 2–Bromo–4–(1H–pyrazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-bromo-4-pyrazol-1-ylphenyl)boronic acid (CAS 2225179-49-5) is a chemical compound with the molecular formula C9H8BBrN2O2 and a molecular weight of 266.89 g/mol. IUPAC name: (2-bromo-4-pyrazol-1-ylphenyl)boronic acid. InChIKey: BODORFINFQMWRU-UHFFFAOYSA-N.
| Molecular formula | C9H8BBrN2O2 |
|---|---|
| Molecular weight | 266.89 g/mol |
| IUPAC name | (2-bromo-4-pyrazol-1-ylphenyl)boronic acid |
| InChIKey | BODORFINFQMWRU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CC=N2)Br)(O)O |
Computed by PubChem (NCBI)