CAS 2225179-79-1 is the registry number for 3–Trifluoromethyl–5–(thiazol–5–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]boronic acid (CAS 2225179-79-1) is a chemical compound with the molecular formula C10H7BF3NO2S and a molecular weight of 273.04 g/mol. IUPAC name: [3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: YZGMMYTZJRPAEU-UHFFFAOYSA-N.
| Molecular formula | C10H7BF3NO2S |
|---|---|
| Molecular weight | 273.04 g/mol |
| IUPAC name | [3-(1,3-thiazol-5-yl)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YZGMMYTZJRPAEU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(F)(F)F)C2=CN=CS2)(O)O |
Computed by PubChem (NCBI)