CAS 2225179-93-9 is the registry number for 4–Methyl–2–(1H–pyrazol–1–yl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(4-methyl-2-pyrazol-1-ylpyrimidin-5-yl)boronic acid (CAS 2225179-93-9) is a chemical compound with the molecular formula C8H9BN4O2 and a molecular weight of 204.00 g/mol. IUPAC name: (4-methyl-2-pyrazol-1-ylpyrimidin-5-yl)boronic acid. InChIKey: CUPQEQHVPOLPBA-UHFFFAOYSA-N.
| Molecular formula | C8H9BN4O2 |
|---|---|
| Molecular weight | 204.00 g/mol |
| IUPAC name | (4-methyl-2-pyrazol-1-ylpyrimidin-5-yl)boronic acid |
| InChIKey | CUPQEQHVPOLPBA-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1C)N2C=CC=N2)(O)O |
Computed by PubChem (NCBI)