CAS 2225180-82-3 is the registry number for 5–Chloro–6–(2–furyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[5-chloro-6-(furan-2-yl)-3-pyridinyl]boronic acid (CAS 2225180-82-3) is a chemical compound with the molecular formula C9H7BClNO3 and a molecular weight of 223.42 g/mol. IUPAC name: [5-chloro-6-(furan-2-yl)-3-pyridinyl]boronic acid. InChIKey: WWWLQPRAVKGLAW-UHFFFAOYSA-N.
| Molecular formula | C9H7BClNO3 |
|---|---|
| Molecular weight | 223.42 g/mol |
| IUPAC name | [5-chloro-6-(furan-2-yl)-3-pyridinyl]boronic acid |
| InChIKey | WWWLQPRAVKGLAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C2=CC=CO2)Cl)(O)O |
Computed by PubChem (NCBI)