Products 2225181-08-6
CAS 2225181-08-6 is the registry number for 3–Cyclopropyl–5–(N–methylpiperazin–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-cyclopropyl-5-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 2225181-08-6) is a chemical compound with the molecular formula C14H21BN2O2 and a molecular weight of 260.14 g/mol. IUPAC name: [3-cyclopropyl-5-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: WTKYFYIZQLIRQT-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O2 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | [3-cyclopropyl-5-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | WTKYFYIZQLIRQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N2CCN(CC2)C)C3CC3)(O)O |
Computed by PubChem (NCBI)