CAS 2225181-76-8 is the registry number for 2,6-Dimethyl-1-((E)-2-nitroethenyl)piperidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,6-dimethyl-1-[(E)-2-nitroethenyl]piperidine (CAS 2225181-76-8) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: 2,6-dimethyl-1-[(E)-2-nitroethenyl]piperidine. InChIKey: BPKXPMUQJBACBP-VOTSOKGWSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2,6-dimethyl-1-[(E)-2-nitroethenyl]piperidine |
| InChIKey | BPKXPMUQJBACBP-VOTSOKGWSA-N |
| SMILES | CC1CCCC(N1/C=C/[N+](=O)[O-])C |
Computed by PubChem (NCBI)