CAS 22256-98-0 appears in our catalog under these names: Diquafosol Impurity 25, Diquafosol Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2S,3R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (CAS 22256-98-0) is a chemical compound with the molecular formula C9H13N2O9P and a molecular weight of 324.18 g/mol. IUPAC name: [(2S,3R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate. InChIKey: DJJCXFVJDGTHFX-PSQAKQOGSA-N.
| Molecular formula | C9H13N2O9P |
|---|---|
| Molecular weight | 324.18 g/mol |
| IUPAC name | [(2S,3R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | DJJCXFVJDGTHFX-PSQAKQOGSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@@H]2[C@H]([C@H]([C@@H](O2)COP(=O)(O)O)O)O |
Computed by PubChem (NCBI)