Products 2225878-48-6

CAS 2225878-48-6 is the registry number for Benzyl 2-((tert-butoxycarbonyl)amino)-4,5-dimethoxybenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 4,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CAS 2225878-48-6) is a chemical compound with the molecular formula C21H25NO6 and a molecular weight of 387.4 g/mol. IUPAC name: benzyl 4,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate. InChIKey: HQLLKTFWZOKXHS-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO6
Molecular weight387.4 g/mol
IUPAC namebenzyl 4,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate
InChIKeyHQLLKTFWZOKXHS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC(=C(C=C1C(=O)OCC2=CC=CC=C2)OC)OC

Computed by PubChem (NCBI)