CAS 2225892-57-7 is the registry number for 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrakis(3-aminobenzoic acid), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-4-[3,6,8-tris(2-amino-4-carboxyphenyl)pyren-1-yl]benzoic acid (CAS 2225892-57-7) is a chemical compound with the molecular formula C44H30N4O8 and a molecular weight of 742.7 g/mol. IUPAC name: 3-amino-4-[3,6,8-tris(2-amino-4-carboxyphenyl)pyren-1-yl]benzoic acid. InChIKey: RSPCAUZRMTXSQD-UHFFFAOYSA-N.
| Molecular formula | C44H30N4O8 |
|---|---|
| Molecular weight | 742.7 g/mol |
| IUPAC name | 3-amino-4-[3,6,8-tris(2-amino-4-carboxyphenyl)pyren-1-yl]benzoic acid |
| InChIKey | RSPCAUZRMTXSQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=C(C=C(C=C6)C(=O)O)N)C7=C(C=C(C=C7)C(=O)O)N)C8=C(C=C(C=C8)C(=O)O)N |
Computed by PubChem (NCBI)