CAS 2225940-48-5 appears in our catalog under these names: Pomalidomide-C4-COOH/ 98.1% (existing batch purity), Pomalidomide 4'–alkylC4–acid, Pomalidomide 4'-alkylC4-acid 95%, PENTANOIC ACID, 5-[[2-(2,6-DIOXO-3-PIPE&, 5-[[2-(2,6-Dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]amino]pentanoic acid, 95%, 95%. Offered by: TargetMol, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 5g, 50mg, 100mg, 250mg.
5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoic acid (CAS 2225940-48-5) is a chemical compound with the molecular formula C18H19N3O6 and a molecular weight of 373.4 g/mol. IUPAC name: 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoic acid. InChIKey: JUPYDAIBDNUUIF-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O6 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoic acid |
| InChIKey | JUPYDAIBDNUUIF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCCCC(=O)O |
Computed by PubChem (NCBI)